new BindingDB logo
myBDB logout

BDBM50045623 CHEMBL3314303::US9540323, 197::US9540323, example 197

SMILES: CC1(C)CN(c2c1c(ccc2O)-c1cc(F)cc(F)c1)c1ccccc1NC(=O)Nc1ccc(OC(F)(F)F)cc1

InChI Key: InChIKey=AJKDKZYPHZFUTF-UHFFFAOYSA-N

Data: 2 KI  2 IC50

Find this compound or compounds like it in BindingDB or PDB:
   Substructure
Similarity at least:  must be >=0.5
Exact match