Details for Substrate BDBM12680 without Explicit Binding Affinity Data | |
| Prothrombin |
| Coagulation factor XII |
| Plasma kallikrein |
Synonyms: | (2S)-N-[(2S)-5-carbamimidamido-2-[(4-nitrophenyl)amino]pentanoyl]-3-phenyl-2-[(2R)-pyrrolidin-2-ylformamido]propanamide | Chromogenic Substrate S-2302 | H-D-Pro-Phe-Arg-p-nitroanilide | prolyl-phenylalanyl-arginine-p-nitroanilide |
Type: | Small organic molecule |
Emp. Form.: | C26H34N8O5 |
Mol. Mass.: | 538.5988 g/mol |
SMILES: | N\C([NH-])=[NH+]/CCCC(NC(=O)C(Cc1ccccc1)NC(=O)C1CCCN1)C(=O)Nc1ccc(cc1)[N+]([O-])=O |
Structure: |
Courtesy of Chemaxon Inc. - Use mouse to adjust image. - Double-click and use "Edit" menu to generate mol-file. |