null
SMILES: CCn1c2ccc(cc2c2cc(C)cc(F)c12)-c1nc2c(C)c(ccc2n1CCOC)C(O)=O
InChI Key: InChIKey=SFNDGBGUJRCQSC-UHFFFAOYSA-N
Target/Host (Institution) | Ligand | Target/Host Links | Ligand Links | Trg + Lig Links | Ki nM | ΔG° kcal/mole | IC50 nM | Kd nM | EC50/IC50 nM | koff s-1 | kon M-1s-1 | pH | Temp °C |
---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Prostaglandin E2 receptor EP4 subtype (Homo sapiens (Human)) | BDBM453702 (2-(9-Ethyl-8-fluoro-6-methyl-9H-carbazol-3-yl)-1-(...) | PDB Reactome pathway KEGG UniProtKB/SwissProt DrugBank antibodypedia GoogleScholar AffyNet | PC cid PC sid UniChem | US Patent | n/a | n/a | 2.40 | n/a | n/a | n/a | n/a | n/a | n/a |
BAYER PHARMA AKTIENGESELLSCHAFT US Patent | Assay Description 5. 1 Detection PrincipleBinding of prostaglandin D2 to the human PGD receptor induces activation of membrane-bound adenylate cyclases and leads to th... | US Patent US10730856 (2020) | |||||||||||
More data for this Ligand-Target Pair |