Neprilysin
(Homo sapiens (Human)) | BDBM300282
(US9593110, 2-16)Show SMILES CCOc1cc(n[nH]1)C(=O)N[C@@H](C[C@@H](COC)C(O)=O)Cc1ccc(cc1)-c1cc(Cl)ccc1F Show InChI InChI=1S/C25H27ClFN3O5/c1-3-35-23-13-22(29-30-23)24(31)28-19(11-17(14-34-2)25(32)33)10-15-4-6-16(7-5-15)20-12-18(26)8-9-21(20)27/h4-9,12-13,17,19H,3,10-11,14H2,1-2H3,(H,28,31)(H,29,30)(H,32,33)/t17-,19+/m0/s1 | PDB
KEGG
UniProtKB/SwissProt
B.MOAD DrugBank antibodypedia GoogleScholar AffyNet
| PC cid PC sid UniChem
| US Patent
| <1 | n/a | n/a | n/a | n/a | n/a | n/a | n/a | n/a |
Theravence Biopharma R&D IP, LLC
US Patent
| Assay Description Recombinant human NEP and recombinant human ACE were obtained commercially (R&D Systems, Minneapolis, Minn., catalog numbers 1182-ZN and 929-ZN, resp... |
US Patent US9593110 (2017)
BindingDB Entry DOI: 10.7270/Q2MC9224 |