Mitotic checkpoint serine/threonine-protein kinase BUB1
(Homo sapiens (Human)) | BDBM415258
(Preparation of 3-(phenylamino)-2-{2-[(3,3,3-triflu...)Show SMILES FC(F)(F)CCNc1cc(ccn1)-c1[nH]c2CCCC(=O)c2c1Nc1ccccc1 Show InChI InChI=1S/C22H21F3N4O/c23-22(24,25)10-12-27-18-13-14(9-11-26-18)20-21(28-15-5-2-1-3-6-15)19-16(29-20)7-4-8-17(19)30/h1-3,5-6,9,11,13,28-29H,4,7-8,10,12H2,(H,26,27) | PDB MMDB
Reactome pathway KEGG
UniProtKB/SwissProt
B.MOAD antibodypedia GoogleScholar AffyNet
| PC cid PC sid UniChem
| US Patent
| n/a | n/a | 604 | n/a | n/a | n/a | n/a | n/a | n/a |
Bayer Pharma Aktiengesellschaft
US Patent
| Assay Description In a typical assay 11 different concentrations of each compound (0.1 nM, 0.33 nM, 1.1 nM, 3.8 nM, 13 nM, 44 nM, 0.15 μM, 0.51 μM, 1.7 μ... |
US Patent US10428044 (2019)
BindingDB Entry DOI: 10.7270/Q2QF8W7J |