Details for Substrate BDBM2 without Explicit Binding Affinity Data | |
| ATP-dependent molecular chaperone HSP82 |
| Kinesin-like protein KIF11 |
| DNA gyrase subunit A/B |
| A disintegrin and metalloproteinase with thrombospondin motifs 5 |
| DNA topoisomerase 4 subunit A/B |
| Sarcoplasmic/endoplasmic reticulum calcium ATPase 1 |
| Tyrosine-protein kinase BTK |
Synonyms: | ({[({[(2R,3S,4R,5R)-5-(6-amino-9H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy}(hydroxy)phosphoryl)oxy](hydroxy)phosphoryl}oxy)phosphonic acid | ATP | Brimonidine ATP | CHEMBL14249 |
Type: | Nucleoside or nucleotide |
Emp. Form.: | C10H16N5O13P3 |
Mol. Mass.: | 507.181 g/mol |
SMILES: | Nc1ncnc2n(cnc12)[C@@H]1O[C@H](COP(O)(=O)OP(O)(=O)OP(O)(O)=O)[C@@H](O)[C@H]1O |r| |
Structure: |
Courtesy of Chemaxon Inc. - Use mouse to adjust image. - Double-click and use "Edit" menu to generate mol-file. |