null
SMILES OC(=O)CCc1cc(Br)c(OCC2CCCCC2)c(Br)c1
InChI Key InChIKey=UQABRPIJAIHKQN-UHFFFAOYSA-N
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 2 hits for monomerid = 18887
Affinity DataIC50: 460nM EC50: 0.530nMpH: 7.0 T: 2°CAssay Description:IIC50 is the concentration of each compound required to inhibit 50% binding of 125I-T3 to hTRalpha. EC50 is the concentration of compound required to...More data for this Ligand-Target Pair
Affinity DataIC50: 190nM EC50: 0.120nMpH: 7.0 T: 2°CAssay Description:IC50 is the concentration of each compound required to inhibit 50% binding of 125I-T3 to hTRbeta. EC50 is the concentration of compound required to i...More data for this Ligand-Target Pair