null
SMILES CC[C@@]1(O)C(=O)OCC2=CN3Cc4cc5ccccc5nc4C3C=C12
InChI Key InChIKey=FBDOJYYTMIHHDH-OZBJMMHXSA-N
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 2 hits for monomerid = 246595
Affinity DataIC50: 2.80E+3nMpH: 7.5Assay Description:In the preincubation assay, CPT concentrations were 50 and 100 μM, whereas various concentrations of compounds were 25, 50 and 100 μM. LdTOP1LS...More data for this Ligand-Target Pair
Affinity DataIC50: 4.20E+3nMpH: 7.5Assay Description:In simultaneous relaxation assay, CPT concentrations were 50 and 100 μM, whereas concentration of compounds were 50, 100 and 200 μM. Relaxation...More data for this Ligand-Target Pair