null
SMILES Cc1ccc(NS(=O)(=O)Cc2ccccc2)c(=O)n1CC(=O)N[C@H]1CCCN(C1O)C(N)=N
InChI Key InChIKey=KECUOJSZXRRSCI-UCFFOFKASA-N
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 5 hits for monomerid = 50289560
Affinity DataIC50: 447nMAssay Description:Inhibitory concentration of the compound required to inhibit human factor Xa enzyme was determinedMore data for this Ligand-Target Pair
Affinity DataIC50: 2.50E+3nMAssay Description:Inhibitory concentration of the compound required to inhibit human plasmin enzyme was determinedMore data for this Ligand-Target Pair
Affinity DataIC50: 11nMAssay Description:Inhibitory concentration of the compound required to inhibit human trypsin enzyme was determinedMore data for this Ligand-Target Pair
Affinity DataIC50: 2.50E+3nMAssay Description:Inhibitory concentration of the compound required to inhibit human Tissue type plasminogen activator was determinedMore data for this Ligand-Target Pair
Affinity DataIC50: 0.467nMAssay Description:Inhibitory concentration of the compound required to inhibit human thrombin enzyme was determinedMore data for this Ligand-Target Pair