null
SMILES CC(C)[C@H](NC(=O)[C@H](CCC(O)=O)NC(=O)[C@@H](NC(C)=O)C(O)=O)C(=O)N[C@H]1CC(=O)OC1O
InChI Key InChIKey=INEQQSYFBJJTKI-FQAXKGDYSA-N
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 5 hits for monomerid = 50119245
Affinity DataIC50: 10nMAssay Description:Inhibitory concentration of compound required against Caspase-7 compared to acylated dipeptidesMore data for this Ligand-Target Pair
Affinity DataIC50: 3.5nMAssay Description:Inhibitory concentration of compound required against Caspase-3 compared to acylated dipeptidesMore data for this Ligand-Target Pair
Affinity DataIC50: 50nMAssay Description:Inhibitory concentration of compound required against Caspase-1 compared to acylated dipeptidesMore data for this Ligand-Target Pair
Affinity DataIC50: 10nMAssay Description:Inhibitory concentration of compound required against Caspase-6 compared to acylated dipeptidesMore data for this Ligand-Target Pair
Affinity DataIC50: 80nMAssay Description:Inhibitory concentration of compound required against Caspase-8 compared to acylated dipeptidesMore data for this Ligand-Target Pair