BDBM224809 US9328124, 12
SMILES: CC(C)(O)c1nc(ncc1F)N1C[C@H]2CSC(N)=N[C@]2(C1)c1ccc(F)cn1
InChI Key: InChIKey=SLRAHGAFCRXRAS-YPMLDQLKSA-N
Data: 1 IC50
Target/Host (Institution) | Ligand | Target/Host Links | Ligand Links | Trg + Lig Links | Ki nM | ΔG° kcal/mole | IC50 nM | Kd nM | EC50/IC50 nM | koff s-1 | kon M-1s-1 | pH | Temp °C |
---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Beta-secretase 1 (aa 1-460) (Homo sapiens (Human)) | BDBM224809 (US9328124, 12) | PDB GoogleScholar AffyNet | PC cid PC sid UniChem | US Patent | n/a | n/a | 73.4 | n/a | n/a | n/a | n/a | 4.6 | 25 |
Eli Lilly and Company US Patent | Assay Description Ten μL of each dilution is added to each well on row A to H of a corresponding low protein binding black plate containing the reaction mixture (25... | US Patent US9328124 (2016) BindingDB Entry DOI: 10.7270/Q2KH0M66 | |||||||||||
More data for this Ligand-Target Pair |